C14H22N6O3 — CID 133287204
2-[2-(4-methylpiperazin-1-yl)propylamino]-5-nitropyridine-3-carboxamide (PubChem CID 133287204) has the molecular formula C14H22N6O3 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-[2-(4-methylpiperazin-1-yl)propylamino]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[2-(4-methylpiperazin-1-yl)propylamino]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133287204 |
| Molecular Formula | C14H22N6O3 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[2-(4-methylpiperazin-1-yl)propylamino]-5-nitropyridine-3-carboxamide |
| SMILES | CC(CNc1ncc([N+](=O)[O-])cc1C(N)=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H22N6O3/c1-10(19-5-3-18(2)4-6-19)8-16-14-12(13(15)21)7-11(9-17-14)20(22)23/h7,9-10H,3-6,8H2,1-2H3,(H2,15,21)(H,16,17) |
| InChIKey | UQUGZAVWMGNBLQ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|