C15H23N5O3 — CID 133491788
2-[[1-[(dimethylamino)methyl]cyclopentyl]methylamino]-5-nitropyridine-3-carboxamide (PubChem CID 133491788) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 2-[[1-[(dimethylamino)methyl]cyclopentyl]methylamino]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[[1-[(dimethylamino)methyl]cyclopentyl]methylamino]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133491788 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-[[1-[(dimethylamino)methyl]cyclopentyl]methylamino]-5-nitropyridine-3-carboxamide |
| SMILES | CN(C)CC1(CNc2ncc([N+](=O)[O-])cc2C(N)=O)CCCC1 |
| InChI | InChI=1S/C15H23N5O3/c1-19(2)10-15(5-3-4-6-15)9-18-14-12(13(16)21)7-11(8-17-14)20(22)23/h7-8H,3-6,9-10H2,1-2H3,(H2,16,21)(H,17,18) |
| InChIKey | XQEPTZDRVQFSEW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|