C14H13FN4O3 — CID 78862249
2-[(3-fluoro-4-methylphenyl)methylamino]-5-nitropyridine-3-carboxamide (PubChem CID 78862249) has the molecular formula C14H13FN4O3 and a molecular weight of 304.28 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methylphenyl)methylamino]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[(3-fluoro-4-methylphenyl)methylamino]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 78862249 |
| Molecular Formula | C14H13FN4O3 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[(3-fluoro-4-methylphenyl)methylamino]-5-nitropyridine-3-carboxamide |
| SMILES | Cc1ccc(CNc2ncc([N+](=O)[O-])cc2C(N)=O)cc1F |
| InChI | InChI=1S/C14H13FN4O3/c1-8-2-3-9(4-12(8)15)6-17-14-11(13(16)20)5-10(7-18-14)19(21)22/h2-5,7H,6H2,1H3,(H2,16,20)(H,17,18) |
| InChIKey | PHCNQWCIQUOYNG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|