C15H14N6O3 — CID 133296638
2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylamino]-5-nitropyridine-3-carboxamide (PubChem CID 133296638) has the molecular formula C15H14N6O3 and a molecular weight of 326.32 g/mol. Its IUPAC name is 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylamino]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylamino]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133296638 |
| Molecular Formula | C15H14N6O3 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[(5-methylimidazo[1,2-a]pyridin-2-yl)methylamino]-5-nitropyridine-3-carboxamide |
| SMILES | Cc1cccc2nc(CNc3ncc([N+](=O)[O-])cc3C(N)=O)cn12 |
| InChI | InChI=1S/C15H14N6O3/c1-9-3-2-4-13-19-10(8-20(9)13)6-17-15-12(14(16)22)5-11(7-18-15)21(23)24/h2-5,7-8H,6H2,1H3,(H2,16,22)(H,17,18) |
| InChIKey | XXASDZRPYOURPU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|