C15H13F3N4O4 — CID 133275354
2-[[4-methoxy-2-(trifluoromethyl)phenyl]methylamino]-5-nitropyridine-3-carboxamide (PubChem CID 133275354) has the molecular formula C15H13F3N4O4 and a molecular weight of 370.29 g/mol. Its IUPAC name is 2-[[4-methoxy-2-(trifluoromethyl)phenyl]methylamino]-5-nitropyridine-3-carboxamide.
| Compound Name | 2-[[4-methoxy-2-(trifluoromethyl)phenyl]methylamino]-5-nitropyridine-3-carboxamide |
|---|---|
| PubChem CID | 133275354 |
| Molecular Formula | C15H13F3N4O4 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-[[4-methoxy-2-(trifluoromethyl)phenyl]methylamino]-5-nitropyridine-3-carboxamide |
| SMILES | COc1ccc(CNc2ncc([N+](=O)[O-])cc2C(N)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13F3N4O4/c1-26-10-3-2-8(12(5-10)15(16,17)18)6-20-14-11(13(19)23)4-9(7-21-14)22(24)25/h2-5,7H,6H2,1H3,(H2,19,23)(H,20,21) |
| InChIKey | FFMMJUHKOPSKSJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|