C16H14F3N3O4 — CID 133275327
2-[[4-methoxy-2-(trifluoromethyl)phenyl]methylamino]-5-nitrobenzamide (PubChem CID 133275327) has the molecular formula C16H14F3N3O4 and a molecular weight of 369.30 g/mol. Its IUPAC name is 2-[[4-methoxy-2-(trifluoromethyl)phenyl]methylamino]-5-nitrobenzamide.
| Compound Name | 2-[[4-methoxy-2-(trifluoromethyl)phenyl]methylamino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 133275327 |
| Molecular Formula | C16H14F3N3O4 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-[[4-methoxy-2-(trifluoromethyl)phenyl]methylamino]-5-nitrobenzamide |
| SMILES | COc1ccc(CNc2ccc([N+](=O)[O-])cc2C(N)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3N3O4/c1-26-11-4-2-9(13(7-11)16(17,18)19)8-21-14-5-3-10(22(24)25)6-12(14)15(20)23/h2-7,21H,8H2,1H3,(H2,20,23) |
| InChIKey | IAZFGNQUAIRYTG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|