C9H7N5O4S — CID 114046882
2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid (PubChem CID 114046882) has the molecular formula C9H7N5O4S and a molecular weight of 281.25 g/mol. Its IUPAC name is 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid.
| Compound Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114046882 |
| Molecular Formula | C9H7N5O4S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyridine-3-carboxylic acid |
| SMILES | Cc1nc(Sc2ncc([N+](=O)[O-])cc2C(=O)O)n[nH]1 |
| InChI | InChI=1S/C9H7N5O4S/c1-4-11-9(13-12-4)19-7-6(8(15)16)2-5(3-10-7)14(17)18/h2-3H,1H3,(H,15,16)(H,11,12,13) |
| InChIKey | JIRNSGIEMJRBFI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|