C8H4N4O4S2 — CID 114046890
5-nitro-2-(1,2,4-thiadiazol-5-ylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 114046890) has the molecular formula C8H4N4O4S2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 5-nitro-2-(1,2,4-thiadiazol-5-ylsulfanyl)pyridine-3-carboxylic acid.
| Compound Name | 5-nitro-2-(1,2,4-thiadiazol-5-ylsulfanyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114046890 |
| Molecular Formula | C8H4N4O4S2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 5-nitro-2-(1,2,4-thiadiazol-5-ylsulfanyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cnc1Sc1ncns1 |
| InChI | InChI=1S/C8H4N4O4S2/c13-7(14)5-1-4(12(15)16)2-9-6(5)17-8-10-3-11-18-8/h1-3H,(H,13,14) |
| InChIKey | XSVANCOWYARDHW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|