C6H4N6O2S2 — CID 80894310
5-nitro-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine (PubChem CID 80894310) has the molecular formula C6H4N6O2S2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 5-nitro-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | 5-nitro-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80894310 |
| Molecular Formula | C6H4N6O2S2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 5-nitro-6-(1,2,4-thiadiazol-5-ylsulfanyl)pyrimidin-4-amine |
| SMILES | Nc1ncnc(Sc2ncns2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N6O2S2/c7-4-3(12(13)14)5(9-1-8-4)15-6-10-2-11-16-6/h1-2H,(H2,7,8,9) |
| InChIKey | VHAGKUZNNDMBDJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|