C10H7N7O2S — CID 112724176
5-nitro-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyrimidin-4-amine (PubChem CID 112724176) has the molecular formula C10H7N7O2S and a molecular weight of 289.28 g/mol. Its IUPAC name is 5-nitro-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyrimidin-4-amine.
| Compound Name | 5-nitro-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112724176 |
| Molecular Formula | C10H7N7O2S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 5-nitro-6-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pyrimidin-4-amine |
| SMILES | Nc1ncnc(Sc2nnc3ccccn23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7N7O2S/c11-8-7(17(18)19)9(13-5-12-8)20-10-15-14-6-3-1-2-4-16(6)10/h1-5H,(H2,11,12,13) |
| InChIKey | DBRGRSFTFGZRNW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 125.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|