C11H8N6O2 — CID 102627390
6-imidazo[1,2-a]pyridin-5-yl-5-nitropyrimidin-4-amine (PubChem CID 102627390) has the molecular formula C11H8N6O2 and a molecular weight of 256.23 g/mol. Its IUPAC name is 6-imidazo[1,2-a]pyridin-5-yl-5-nitropyrimidin-4-amine.
| Compound Name | 6-imidazo[1,2-a]pyridin-5-yl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 102627390 |
| Molecular Formula | C11H8N6O2 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 6-imidazo[1,2-a]pyridin-5-yl-5-nitropyrimidin-4-amine |
| SMILES | Nc1ncnc(-c2cccc3nccn23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8N6O2/c12-11-10(17(18)19)9(14-6-15-11)7-2-1-3-8-13-4-5-16(7)8/h1-6H,(H2,12,14,15) |
| InChIKey | WXTGULVNRVQYHY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|