C11H7ClN4 — CID 102627237
5-(5-chloropyrimidin-4-yl)imidazo[1,2-a]pyridine (PubChem CID 102627237) has the molecular formula C11H7ClN4 and a molecular weight of 230.66 g/mol. Its IUPAC name is 5-(5-chloropyrimidin-4-yl)imidazo[1,2-a]pyridine.
| Compound Name | 5-(5-chloropyrimidin-4-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 102627237 |
| Molecular Formula | C11H7ClN4 |
| Molecular Weight | 230.66 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 5-(5-chloropyrimidin-4-yl)imidazo[1,2-a]pyridine |
| SMILES | Clc1cncnc1-c1cccc2nccn12 |
| InChI | InChI=1S/C11H7ClN4/c12-8-6-13-7-15-11(8)9-2-1-3-10-14-4-5-16(9)10/h1-7H |
| InChIKey | AWOYZHTVJBPTKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.66 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |