C13H7ClF3N3 — CID 102716508
5-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]imidazo[1,2-a]pyridine (PubChem CID 102716508) has the molecular formula C13H7ClF3N3 and a molecular weight of 297.67 g/mol. Its IUPAC name is 5-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]imidazo[1,2-a]pyridine.
| Compound Name | 5-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 102716508 |
| Molecular Formula | C13H7ClF3N3 |
| Molecular Weight | 297.67 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 5-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]imidazo[1,2-a]pyridine |
| SMILES | FC(F)(F)c1cc(Cl)nc(-c2cccc3nccn23)c1 |
| InChI | InChI=1S/C13H7ClF3N3/c14-11-7-8(13(15,16)17)6-9(19-11)10-2-1-3-12-18-4-5-20(10)12/h1-7H |
| InChIKey | MJKCEGXHYHDYAR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.67 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|