C12H5ClF5N — CID 102716375
2-chloro-6-(3,5-difluorophenyl)-4-(trifluoromethyl)pyridine (PubChem CID 102716375) has the molecular formula C12H5ClF5N and a molecular weight of 293.62 g/mol. Its IUPAC name is 2-chloro-6-(3,5-difluorophenyl)-4-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-6-(3,5-difluorophenyl)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 102716375 |
| Molecular Formula | C12H5ClF5N |
| Molecular Weight | 293.62 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 2-chloro-6-(3,5-difluorophenyl)-4-(trifluoromethyl)pyridine |
| SMILES | Fc1cc(F)cc(-c2cc(C(F)(F)F)cc(Cl)n2)c1 |
| InChI | InChI=1S/C12H5ClF5N/c13-11-4-7(12(16,17)18)3-10(19-11)6-1-8(14)5-9(15)2-6/h1-5H |
| InChIKey | UNTINGCIRUSMGV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|