C13H9ClF2N2 — CID 80952148
4-chloro-2-cyclopropyl-6-(3,5-difluorophenyl)pyrimidine (PubChem CID 80952148) has the molecular formula C13H9ClF2N2 and a molecular weight of 266.68 g/mol. Its IUPAC name is 4-chloro-2-cyclopropyl-6-(3,5-difluorophenyl)pyrimidine.
| Compound Name | 4-chloro-2-cyclopropyl-6-(3,5-difluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 80952148 |
| Molecular Formula | C13H9ClF2N2 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 4-chloro-2-cyclopropyl-6-(3,5-difluorophenyl)pyrimidine |
| SMILES | Fc1cc(F)cc(-c2cc(Cl)nc(C3CC3)n2)c1 |
| InChI | InChI=1S/C13H9ClF2N2/c14-12-6-11(17-13(18-12)7-1-2-7)8-3-9(15)5-10(16)4-8/h3-7H,1-2H2 |
| InChIKey | LXWCFHQZCLSVAA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |