C13H9Cl3FN3 — CID 107576837
6-chloro-2-cyclopropyl-N-(3,5-dichloro-4-fluorophenyl)pyrimidin-4-amine (PubChem CID 107576837) has the molecular formula C13H9Cl3FN3 and a molecular weight of 332.59 g/mol. Its IUPAC name is 6-chloro-2-cyclopropyl-N-(3,5-dichloro-4-fluorophenyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-2-cyclopropyl-N-(3,5-dichloro-4-fluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107576837 |
| Molecular Formula | C13H9Cl3FN3 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 6-chloro-2-cyclopropyl-N-(3,5-dichloro-4-fluorophenyl)pyrimidin-4-amine |
| SMILES | Fc1c(Cl)cc(Nc2cc(Cl)nc(C3CC3)n2)cc1Cl |
| InChI | InChI=1S/C13H9Cl3FN3/c14-8-3-7(4-9(15)12(8)17)18-11-5-10(16)19-13(20-11)6-1-2-6/h3-6H,1-2H2,(H,18,19,20) |
| InChIKey | JWJDDPCQEYAQOF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|