C14H13Cl2FN4 — CID 107580777
2-cyclopropyl-4-N-(3,5-dichloro-4-fluorophenyl)-6-N-methylpyrimidine-4,6-diamine (PubChem CID 107580777) has the molecular formula C14H13Cl2FN4 and a molecular weight of 327.19 g/mol. Its IUPAC name is 2-cyclopropyl-4-N-(3,5-dichloro-4-fluorophenyl)-6-N-methylpyrimidine-4,6-diamine.
| Compound Name | 2-cyclopropyl-4-N-(3,5-dichloro-4-fluorophenyl)-6-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107580777 |
| Molecular Formula | C14H13Cl2FN4 |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-cyclopropyl-4-N-(3,5-dichloro-4-fluorophenyl)-6-N-methylpyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2cc(Cl)c(F)c(Cl)c2)nc(C2CC2)n1 |
| InChI | InChI=1S/C14H13Cl2FN4/c1-18-11-6-12(21-14(20-11)7-2-3-7)19-8-4-9(15)13(17)10(16)5-8/h4-7H,2-3H2,1H3,(H2,18,19,20,21) |
| InChIKey | HLJGIIDJZJVADB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|