C12H11F3N4 — CID 80825639
6-N,2-dimethyl-4-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 80825639) has the molecular formula C12H11F3N4 and a molecular weight of 268.24 g/mol. Its IUPAC name is 6-N,2-dimethyl-4-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N,2-dimethyl-4-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80825639 |
| Molecular Formula | C12H11F3N4 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 6-N,2-dimethyl-4-N-(3,4,5-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | CNc1cc(Nc2cc(F)c(F)c(F)c2)nc(C)n1 |
| InChI | InChI=1S/C12H11F3N4/c1-6-17-10(16-2)5-11(18-6)19-7-3-8(13)12(15)9(14)4-7/h3-5H,1-2H3,(H2,16,17,18,19) |
| InChIKey | ACSFPPFNUKMVMB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|