C7H6Cl2FN — CID 103579814
3,5-dichloro-4-fluoro-N-methylaniline (PubChem CID 103579814) has the molecular formula C7H6Cl2FN and a molecular weight of 194.04 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-methylaniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 103579814 |
| Molecular Formula | C7H6Cl2FN |
| Molecular Weight | 194.04 g/mol |
| Exact Mass | 192.99 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-methylaniline |
| SMILES | CNc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C7H6Cl2FN/c1-11-4-2-5(8)7(10)6(9)3-4/h2-3,11H,1H3 |
| InChIKey | INOYNMWFHARIJS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.04 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|