C10H8Cl2FN — CID 107573881
N-but-2-ynyl-3,5-dichloro-4-fluoroaniline (PubChem CID 107573881) has the molecular formula C10H8Cl2FN and a molecular weight of 232.08 g/mol. Its IUPAC name is N-but-2-ynyl-3,5-dichloro-4-fluoroaniline.
| Compound Name | N-but-2-ynyl-3,5-dichloro-4-fluoroaniline |
|---|---|
| PubChem CID | 107573881 |
| Molecular Formula | C10H8Cl2FN |
| Molecular Weight | 232.08 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | N-but-2-ynyl-3,5-dichloro-4-fluoroaniline |
| SMILES | CC#CCNc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2FN/c1-2-3-4-14-7-5-8(11)10(13)9(12)6-7/h5-6,14H,4H2,1H3 |
| InChIKey | PFKGKSCHRFJZSN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|