C11H14Cl2FNS — CID 107573015
3,5-dichloro-N-(3-ethylsulfanylpropyl)-4-fluoroaniline (PubChem CID 107573015) has the molecular formula C11H14Cl2FNS and a molecular weight of 282.21 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-ethylsulfanylpropyl)-4-fluoroaniline.
| Compound Name | 3,5-dichloro-N-(3-ethylsulfanylpropyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 107573015 |
| Molecular Formula | C11H14Cl2FNS |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 3,5-dichloro-N-(3-ethylsulfanylpropyl)-4-fluoroaniline |
| SMILES | CCSCCCNc1cc(Cl)c(F)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2FNS/c1-2-16-5-3-4-15-8-6-9(12)11(14)10(13)7-8/h6-7,15H,2-5H2,1H3 |
| InChIKey | VHNAGQOYBZVLCQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|