C10H8Cl2FN3O — CID 107914951
3,5-dichloro-4-fluoro-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline (PubChem CID 107914951) has the molecular formula C10H8Cl2FN3O and a molecular weight of 276.10 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 107914951 |
| Molecular Formula | C10H8Cl2FN3O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline |
| SMILES | Cc1nnc(CNc2cc(Cl)c(F)c(Cl)c2)o1 |
| InChI | InChI=1S/C10H8Cl2FN3O/c1-5-15-16-9(17-5)4-14-6-2-7(11)10(13)8(12)3-6/h2-3,14H,4H2,1H3 |
| InChIKey | DSIIDFQWXZZLBA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|