C12H17N3O — CID 143900206
ethane;N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline (PubChem CID 143900206) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is ethane;N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline.
| Compound Name | ethane;N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 143900206 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | ethane;N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline |
| SMILES | CC.Cc1nnc(CNc2ccccc2)o1 |
| InChI | InChI=1S/C10H11N3O.C2H6/c1-8-12-13-10(14-8)7-11-9-5-3-2-4-6-9;1-2/h2-6,11H,7H2,1H3;1-2H3 |
| InChIKey | PCFBBEBFCRNEJP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |