C10H10IN3O — CID 103604764
4-iodo-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline (PubChem CID 103604764) has the molecular formula C10H10IN3O and a molecular weight of 315.11 g/mol. Its IUPAC name is 4-iodo-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline.
| Compound Name | 4-iodo-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 103604764 |
| Molecular Formula | C10H10IN3O |
| Molecular Weight | 315.11 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 4-iodo-N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]aniline |
| SMILES | Cc1nnc(CNc2ccc(I)cc2)o1 |
| InChI | InChI=1S/C10H10IN3O/c1-7-13-14-10(15-7)6-12-9-4-2-8(11)3-5-9/h2-5,12H,6H2,1H3 |
| InChIKey | IOHYFEQCDOCOSR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.11 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|