C12H14BrN — CID 107573539
4-bromo-N-but-2-ynyl-3,5-dimethylaniline (PubChem CID 107573539) has the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. Its IUPAC name is 4-bromo-N-but-2-ynyl-3,5-dimethylaniline.
| Compound Name | 4-bromo-N-but-2-ynyl-3,5-dimethylaniline |
|---|---|
| PubChem CID | 107573539 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 4-bromo-N-but-2-ynyl-3,5-dimethylaniline |
| SMILES | CC#CCNc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C12H14BrN/c1-4-5-6-14-11-7-9(2)12(13)10(3)8-11/h7-8,14H,6H2,1-3H3 |
| InChIKey | SJVZXTYNQUFLLH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|