C12H15BrN2 — CID 107573585
3-(4-bromo-3,5-dimethylanilino)-2-methylpropanenitrile (PubChem CID 107573585) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylanilino)-2-methylpropanenitrile.
| Compound Name | 3-(4-bromo-3,5-dimethylanilino)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 107573585 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylanilino)-2-methylpropanenitrile |
| SMILES | Cc1cc(NCC(C)C#N)cc(C)c1Br |
| InChI | InChI=1S/C12H15BrN2/c1-8(6-14)7-15-11-4-9(2)12(13)10(3)5-11/h4-5,8,15H,7H2,1-3H3 |
| InChIKey | AMWGMYGSERLFTR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |