C17H17BrN2 — CID 107573699
4-[(4-bromo-3,5-dimethylanilino)methyl]-3-methylbenzonitrile (PubChem CID 107573699) has the molecular formula C17H17BrN2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 4-[(4-bromo-3,5-dimethylanilino)methyl]-3-methylbenzonitrile.
| Compound Name | 4-[(4-bromo-3,5-dimethylanilino)methyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 107573699 |
| Molecular Formula | C17H17BrN2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-[(4-bromo-3,5-dimethylanilino)methyl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1CNc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C17H17BrN2/c1-11-6-14(9-19)4-5-15(11)10-20-16-7-12(2)17(18)13(3)8-16/h4-8,20H,10H2,1-3H3 |
| InChIKey | YMPYKEZGMGLGHS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |