C16H15BrN2 — CID 107936050
2-[(4-bromo-3,5-dimethylanilino)methyl]benzonitrile (PubChem CID 107936050) has the molecular formula C16H15BrN2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 2-[(4-bromo-3,5-dimethylanilino)methyl]benzonitrile.
| Compound Name | 2-[(4-bromo-3,5-dimethylanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107936050 |
| Molecular Formula | C16H15BrN2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 2-[(4-bromo-3,5-dimethylanilino)methyl]benzonitrile |
| SMILES | Cc1cc(NCc2ccccc2C#N)cc(C)c1Br |
| InChI | InChI=1S/C16H15BrN2/c1-11-7-15(8-12(2)16(11)17)19-10-14-6-4-3-5-13(14)9-18/h3-8,19H,10H2,1-2H3 |
| InChIKey | PNXADTNQDUZAMM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |