C17H18N2O3 — CID 43825981
2-[(3,4,5-trimethoxyanilino)methyl]benzonitrile (PubChem CID 43825981) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[(3,4,5-trimethoxyanilino)methyl]benzonitrile.
| Compound Name | 2-[(3,4,5-trimethoxyanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 43825981 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[(3,4,5-trimethoxyanilino)methyl]benzonitrile |
| SMILES | COc1cc(NCc2ccccc2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C17H18N2O3/c1-20-15-8-14(9-16(21-2)17(15)22-3)19-11-13-7-5-4-6-12(13)10-18/h4-9,19H,11H2,1-3H3 |
| InChIKey | NWZUSEWSZKUYAV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|