C17H22N2O4 — CID 142222409
N-[(5-amino-2-methoxyphenyl)methyl]-3,4,5-trimethoxyaniline (PubChem CID 142222409) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is N-[(5-amino-2-methoxyphenyl)methyl]-3,4,5-trimethoxyaniline.
| Compound Name | N-[(5-amino-2-methoxyphenyl)methyl]-3,4,5-trimethoxyaniline |
|---|---|
| PubChem CID | 142222409 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | N-[(5-amino-2-methoxyphenyl)methyl]-3,4,5-trimethoxyaniline |
| SMILES | COc1ccc(N)cc1CNc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H22N2O4/c1-20-14-6-5-12(18)7-11(14)10-19-13-8-15(21-2)17(23-4)16(9-13)22-3/h5-9,19H,10,18H2,1-4H3 |
| InChIKey | KLCJJPMVDRVPJR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|