C10H12N4OS — CID 65275654
N-[(5-amino-2-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 65275654) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is N-[(5-amino-2-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[(5-amino-2-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65275654 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | N-[(5-amino-2-methoxyphenyl)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | COc1ccc(N)cc1CNc1ncns1 |
| InChI | InChI=1S/C10H12N4OS/c1-15-9-3-2-8(11)4-7(9)5-12-10-13-6-14-16-10/h2-4,6H,5,11H2,1H3,(H,12,13,14) |
| InChIKey | XPIVCNKTPZKZAD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|