C38H46N10O6 — CID 70422933
5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine (PubChem CID 70422933) has the molecular formula C38H46N10O6 and a molecular weight of 738.85 g/mol. Its IUPAC name is 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine.
| Compound Name | 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 70422933 |
| Molecular Formula | C38H46N10O6 |
| Molecular Weight | 738.85 g/mol |
| Exact Mass | 738.36 |
| IUPAC Name | 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine |
| SMILES | COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC.COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC |
| InChI | InChI=1S/2C19H23N5O3/c2*1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h2*5-8,22H,9H2,1-4H3,(H4,20,21,23,24) |
| InChIKey | ORJAZSMEELQQSN-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 235.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.85 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|