C20H25Cl2N5O5 — CID 134114923
3-[4-[(2,4-diaminoquinazolin-6-yl)methylamino]-2,6-dimethoxyphenoxy]propanoic acid;dihydrochloride (PubChem CID 134114923) has the molecular formula C20H25Cl2N5O5 and a molecular weight of 486.36 g/mol. Its IUPAC name is 3-[4-[(2,4-diaminoquinazolin-6-yl)methylamino]-2,6-dimethoxyphenoxy]propanoic acid;dihydrochloride.
| Compound Name | 3-[4-[(2,4-diaminoquinazolin-6-yl)methylamino]-2,6-dimethoxyphenoxy]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 134114923 |
| Molecular Formula | C20H25Cl2N5O5 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-[4-[(2,4-diaminoquinazolin-6-yl)methylamino]-2,6-dimethoxyphenoxy]propanoic acid;dihydrochloride |
| SMILES | COc1cc(NCc2ccc3nc(N)nc(N)c3c2)cc(OC)c1OCCC(=O)O.Cl.Cl |
| InChI | InChI=1S/C20H23N5O5.2ClH/c1-28-15-8-12(9-16(29-2)18(15)30-6-5-17(26)27)23-10-11-3-4-14-13(7-11)19(21)25-20(22)24-14;;/h3-4,7-9,23H,5-6,10H2,1-2H3,(H,26,27)(H4,21,22,24,25);2*1H |
| InChIKey | JWLPOYRJCWVCFJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|