C16H17N5O — CID 44533101
6-N-[(4-methoxyphenyl)methyl]quinazoline-2,4,6-triamine (PubChem CID 44533101) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 6-N-[(4-methoxyphenyl)methyl]quinazoline-2,4,6-triamine.
| Compound Name | 6-N-[(4-methoxyphenyl)methyl]quinazoline-2,4,6-triamine |
|---|---|
| PubChem CID | 44533101 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 6-N-[(4-methoxyphenyl)methyl]quinazoline-2,4,6-triamine |
| SMILES | COc1ccc(CNc2ccc3nc(N)nc(N)c3c2)cc1 |
| InChI | InChI=1S/C16H17N5O/c1-22-12-5-2-10(3-6-12)9-19-11-4-7-14-13(8-11)15(17)21-16(18)20-14/h2-8,19H,9H2,1H3,(H4,17,18,20,21) |
| InChIKey | RQSBJSIIKPEFOX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |