C22H19N5O — CID 86107032
2-[(2,4-diaminoquinazolin-6-yl)methylamino]-9H-fluoren-9-ol (PubChem CID 86107032) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-[(2,4-diaminoquinazolin-6-yl)methylamino]-9H-fluoren-9-ol.
| Compound Name | 2-[(2,4-diaminoquinazolin-6-yl)methylamino]-9H-fluoren-9-ol |
|---|---|
| PubChem CID | 86107032 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[(2,4-diaminoquinazolin-6-yl)methylamino]-9H-fluoren-9-ol |
| SMILES | Nc1nc(N)c2cc(CNc3ccc4c(c3)C(O)c3ccccc3-4)ccc2n1 |
| InChI | InChI=1S/C22H19N5O/c23-21-18-9-12(5-8-19(18)26-22(24)27-21)11-25-13-6-7-15-14-3-1-2-4-16(14)20(28)17(15)10-13/h1-10,20,25,28H,11H2,(H4,23,24,26,27) |
| InChIKey | YCVPDMOGYAENCS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |