C18H18N4O5 — CID 69175927
(3,4,5-trimethoxyphenyl) 2,4-diaminoquinazoline-6-carboxylate (PubChem CID 69175927) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) 2,4-diaminoquinazoline-6-carboxylate.
| Compound Name | (3,4,5-trimethoxyphenyl) 2,4-diaminoquinazoline-6-carboxylate |
|---|---|
| PubChem CID | 69175927 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) 2,4-diaminoquinazoline-6-carboxylate |
| SMILES | COc1cc(OC(=O)c2ccc3nc(N)nc(N)c3c2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18N4O5/c1-24-13-7-10(8-14(25-2)15(13)26-3)27-17(23)9-4-5-12-11(6-9)16(19)22-18(20)21-12/h4-8H,1-3H3,(H4,19,20,21,22) |
| InChIKey | MDQUCQMVMRWLLX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 131.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|