C17H18ClN5O2 — CID 169435987
5-chloro-6-[(3,4-dimethoxyanilino)methyl]quinazoline-2,4-diamine (PubChem CID 169435987) has the molecular formula C17H18ClN5O2 and a molecular weight of 359.82 g/mol. Its IUPAC name is 5-chloro-6-[(3,4-dimethoxyanilino)methyl]quinazoline-2,4-diamine.
| Compound Name | 5-chloro-6-[(3,4-dimethoxyanilino)methyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 169435987 |
| Molecular Formula | C17H18ClN5O2 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 5-chloro-6-[(3,4-dimethoxyanilino)methyl]quinazoline-2,4-diamine |
| SMILES | COc1ccc(NCc2ccc3nc(N)nc(N)c3c2Cl)cc1OC |
| InChI | InChI=1S/C17H18ClN5O2/c1-24-12-6-4-10(7-13(12)25-2)21-8-9-3-5-11-14(15(9)18)16(19)23-17(20)22-11/h3-7,21H,8H2,1-2H3,(H4,19,20,22,23) |
| InChIKey | KPAGOYKZJYIUDY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|