C26H29N7O3 — CID 174821839
1H-benzimidazole;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine (PubChem CID 174821839) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1H-benzimidazole;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine.
| Compound Name | 1H-benzimidazole;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 174821839 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1H-benzimidazole;5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine |
| SMILES | COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C19H23N5O3.C7H6N2/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3;1-2-4-7-6(3-1)8-5-9-7/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24);1-5H,(H,8,9) |
| InChIKey | YGUDYURUCXVONN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 146.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|