C22H36N2O4 — CID 142222174
ethane;3,4,5-trimethoxy-N-[[2-methoxy-5-(methylamino)phenyl]methyl]aniline (PubChem CID 142222174) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is ethane;3,4,5-trimethoxy-N-[[2-methoxy-5-(methylamino)phenyl]methyl]aniline.
| Compound Name | ethane;3,4,5-trimethoxy-N-[[2-methoxy-5-(methylamino)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 142222174 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | ethane;3,4,5-trimethoxy-N-[[2-methoxy-5-(methylamino)phenyl]methyl]aniline |
| SMILES | CC.CC.CNc1ccc(OC)c(CNc2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C18H24N2O4.2C2H6/c1-19-13-6-7-15(21-2)12(8-13)11-20-14-9-16(22-3)18(24-5)17(10-14)23-4;2*1-2/h6-10,19-20H,11H2,1-5H3;2*1-2H3 |
| InChIKey | VUMDQOXLBKAXCM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|