C16H17Cl2NO3 — CID 23766005
3,5-dichloro-N-[(3,4,5-trimethoxyphenyl)methyl]aniline (PubChem CID 23766005) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is 3,5-dichloro-N-[(3,4,5-trimethoxyphenyl)methyl]aniline.
| Compound Name | 3,5-dichloro-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 23766005 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 3,5-dichloro-N-[(3,4,5-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1cc(CNc2cc(Cl)cc(Cl)c2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17Cl2NO3/c1-20-14-4-10(5-15(21-2)16(14)22-3)9-19-13-7-11(17)6-12(18)8-13/h4-8,19H,9H2,1-3H3 |
| InChIKey | CDBKEUCCKGMRTM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |