C9H7Cl2FN2O2 — CID 155255266
(2Z)-2-[(3,5-dichloro-4-fluorophenyl)hydrazinylidene]propanoic acid (PubChem CID 155255266) has the molecular formula C9H7Cl2FN2O2 and a molecular weight of 265.07 g/mol. Its IUPAC name is (2Z)-2-[(3,5-dichloro-4-fluorophenyl)hydrazinylidene]propanoic acid.
| Compound Name | (2Z)-2-[(3,5-dichloro-4-fluorophenyl)hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 155255266 |
| Molecular Formula | C9H7Cl2FN2O2 |
| Molecular Weight | 265.07 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | (2Z)-2-[(3,5-dichloro-4-fluorophenyl)hydrazinylidene]propanoic acid |
| SMILES | C/C(=N/Nc1cc(Cl)c(F)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C9H7Cl2FN2O2/c1-4(9(15)16)13-14-5-2-6(10)8(12)7(11)3-5/h2-3,14H,1H3,(H,15,16)/b13-4- |
| InChIKey | YOAHDCJNDPEIFB-PQMHYQBVSA-N |
| XLogP | 3.00 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.07 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|