C12H14N4O4 — CID 23269447
(2Z)-2-[[3-[(2Z)-2-(1-carboxyethylidene)hydrazinyl]phenyl]hydrazinylidene]propanoic acid (PubChem CID 23269447) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is (2Z)-2-[[3-[(2Z)-2-(1-carboxyethylidene)hydrazinyl]phenyl]hydrazinylidene]propanoic acid.
| Compound Name | (2Z)-2-[[3-[(2Z)-2-(1-carboxyethylidene)hydrazinyl]phenyl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 23269447 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (2Z)-2-[[3-[(2Z)-2-(1-carboxyethylidene)hydrazinyl]phenyl]hydrazinylidene]propanoic acid |
| SMILES | C/C(=N/Nc1cccc(N/N=C(/C)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C12H14N4O4/c1-7(11(17)18)13-15-9-4-3-5-10(6-9)16-14-8(2)12(19)20/h3-6,15-16H,1-2H3,(H,17,18)(H,19,20)/b13-7-,14-8- |
| InChIKey | WERURNKNKUAVFX-PVRNWPCDSA-N |
| XLogP | 1.43 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|