C14H18N4O4 — CID 6392506
(2E)-2-[[3-[(2E)-2-(1-carboxypropylidene)hydrazinyl]phenyl]hydrazinylidene]butanoic acid (PubChem CID 6392506) has the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. Its IUPAC name is (2E)-2-[[3-[(2E)-2-(1-carboxypropylidene)hydrazinyl]phenyl]hydrazinylidene]butanoic acid.
| Compound Name | (2E)-2-[[3-[(2E)-2-(1-carboxypropylidene)hydrazinyl]phenyl]hydrazinylidene]butanoic acid |
|---|---|
| PubChem CID | 6392506 |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2E)-2-[[3-[(2E)-2-(1-carboxypropylidene)hydrazinyl]phenyl]hydrazinylidene]butanoic acid |
| SMILES | CC/C(=N\Nc1cccc(N/N=C(\CC)C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C14H18N4O4/c1-3-11(13(19)20)17-15-9-6-5-7-10(8-9)16-18-12(4-2)14(21)22/h5-8,15-16H,3-4H2,1-2H3,(H,19,20)(H,21,22)/b17-11+,18-12+ |
| InChIKey | AJKNHGCVTGKWRP-JYFOCSDGSA-N |
| XLogP | 2.21 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|