C9H11N3O2 — CID 68518581
(2Z)-2-amino-2-[(3-methylphenyl)hydrazinylidene]acetic acid (PubChem CID 68518581) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is (2Z)-2-amino-2-[(3-methylphenyl)hydrazinylidene]acetic acid.
| Compound Name | (2Z)-2-amino-2-[(3-methylphenyl)hydrazinylidene]acetic acid |
|---|---|
| PubChem CID | 68518581 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (2Z)-2-amino-2-[(3-methylphenyl)hydrazinylidene]acetic acid |
| SMILES | Cc1cccc(N/N=C(\N)C(=O)O)c1 |
| InChI | InChI=1S/C9H11N3O2/c1-6-3-2-4-7(5-6)11-12-8(10)9(13)14/h2-5,11H,1H3,(H2,10,12)(H,13,14) |
| InChIKey | YOYNFEMZRMZPFV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|