C10H8ClF3N2O2 — CID 134113266
(2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]hydrazinylidene]propanoic acid (PubChem CID 134113266) has the molecular formula C10H8ClF3N2O2 and a molecular weight of 280.63 g/mol. Its IUPAC name is (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]hydrazinylidene]propanoic acid.
| Compound Name | (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 134113266 |
| Molecular Formula | C10H8ClF3N2O2 |
| Molecular Weight | 280.63 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]hydrazinylidene]propanoic acid |
| SMILES | C/C(=N\Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C10H8ClF3N2O2/c1-5(9(17)18)15-16-6-2-3-8(11)7(4-6)10(12,13)14/h2-4,16H,1H3,(H,17,18)/b15-5+ |
| InChIKey | USFBWQIIJTWHNQ-PJQLUOCWSA-N |
| XLogP | 3.23 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.63 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|