C14H7Cl2F6N3 — CID 10549082
4-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-(trifluoromethyl)aniline (PubChem CID 10549082) has the molecular formula C14H7Cl2F6N3 and a molecular weight of 402.13 g/mol. Its IUPAC name is 4-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 10549082 |
| Molecular Formula | C14H7Cl2F6N3 |
| Molecular Weight | 402.13 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 4-chloro-N-[[4-chloro-3-(trifluoromethyl)phenyl]diazenyl]-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cc(/N=N/Nc2ccc(Cl)c(C(F)(F)F)c2)ccc1Cl |
| InChI | InChI=1S/C14H7Cl2F6N3/c15-11-3-1-7(5-9(11)13(17,18)19)23-25-24-8-2-4-12(16)10(6-8)14(20,21)22/h1-6H,(H,23,24) |
| InChIKey | UMCBDFKFYOZVOW-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.13 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|