C14H10ClF4N3 — CID 147351082
1-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-fluorophenyl)guanidine (PubChem CID 147351082) has the molecular formula C14H10ClF4N3 and a molecular weight of 331.70 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-fluorophenyl)guanidine.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-fluorophenyl)guanidine |
|---|---|
| PubChem CID | 147351082 |
| Molecular Formula | C14H10ClF4N3 |
| Molecular Weight | 331.70 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-2-(4-fluorophenyl)guanidine |
| SMILES | N/C(=N\c1ccc(F)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H10ClF4N3/c15-12-6-5-10(7-11(12)14(17,18)19)22-13(20)21-9-3-1-8(16)2-4-9/h1-7H,(H3,20,21,22) |
| InChIKey | DFKFVNFYROTOFN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.70 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|