C15H10Cl2F6N3+ — CID 21065082
[amino-[4-chloro-3-(trifluoromethyl)anilino]methylidene]-[4-chloro-3-(trifluoromethyl)phenyl]azanium (PubChem CID 21065082) has the molecular formula C15H10Cl2F6N3+ and a molecular weight of 417.16 g/mol. Its IUPAC name is [amino-[4-chloro-3-(trifluoromethyl)anilino]methylidene]-[4-chloro-3-(trifluoromethyl)phenyl]azanium.
| Compound Name | [amino-[4-chloro-3-(trifluoromethyl)anilino]methylidene]-[4-chloro-3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 21065082 |
| Molecular Formula | C15H10Cl2F6N3+ |
| Molecular Weight | 417.16 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | [amino-[4-chloro-3-(trifluoromethyl)anilino]methylidene]-[4-chloro-3-(trifluoromethyl)phenyl]azanium |
| SMILES | N/C(Nc1ccc(Cl)c(C(F)(F)F)c1)=[NH+]\c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H9Cl2F6N3/c16-11-3-1-7(5-9(11)14(18,19)20)25-13(24)26-8-2-4-12(17)10(6-8)15(21,22)23/h1-6H,(H3,24,25,26)/p+1 |
| InChIKey | PHRHZVGUINRMNA-UHFFFAOYSA-O |
| XLogP | 4.17 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.16 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|