C8H9ClF3N4+ — CID 59135399
[amino(hydrazinyl)methylidene]-[4-chloro-3-(trifluoromethyl)phenyl]azanium (PubChem CID 59135399) has the molecular formula C8H9ClF3N4+ and a molecular weight of 253.63 g/mol. Its IUPAC name is [amino(hydrazinyl)methylidene]-[4-chloro-3-(trifluoromethyl)phenyl]azanium.
| Compound Name | [amino(hydrazinyl)methylidene]-[4-chloro-3-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 59135399 |
| Molecular Formula | C8H9ClF3N4+ |
| Molecular Weight | 253.63 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | [amino(hydrazinyl)methylidene]-[4-chloro-3-(trifluoromethyl)phenyl]azanium |
| SMILES | NN/C(N)=[NH+]/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C8H8ClF3N4/c9-6-2-1-4(15-7(13)16-14)3-5(6)8(10,11)12/h1-3H,14H2,(H3,13,15,16)/p+1 |
| InChIKey | NHWDYSCXKVCYFS-UHFFFAOYSA-O |
| XLogP | -0.15 |
| TPSA | 78.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.63 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|