2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid

C8H3Cl2FO3 — CID 117345896

IUPAC2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid
SMILESO=C(O)C(=O)c1cc(Cl)c(F)c(Cl)c1
InChIInChI=1S/C8H3Cl2FO3/c9-4-1-3(7(12)8(13)14)2-5(10)6(4)11/h1-2H,(H,13,14)
InChIKeyGPWBAPMTMNCCAS-UHFFFAOYSA-N
MW237.01 g/mol
LogP2.40
Rot. Bonds2

About 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid

2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid (PubChem CID 117345896) has the molecular formula C8H3Cl2FO3 and a molecular weight of 237.01 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid
PubChem CID117345896
Molecular FormulaC8H3Cl2FO3
Molecular Weight237.01 g/mol
Exact Mass235.94
IUPAC Name2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid
SMILESO=C(O)C(=O)c1cc(Cl)c(F)c(Cl)c1
InChIInChI=1S/C8H3Cl2FO3/c9-4-1-3(7(12)8(13)14)2-5(10)6(4)11/h1-2H,(H,13,14)
InChIKeyGPWBAPMTMNCCAS-UHFFFAOYSA-N
XLogP2.40
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.01
LogP ≤ 52.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid?
The IUPAC name of 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid (CID 117345896) is 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid.
What is the SMILES notation for 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid?
The canonical SMILES for 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid is O=C(O)C(=O)c1cc(Cl)c(F)c(Cl)c1.
What is the InChIKey of 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid?
The InChIKey is GPWBAPMTMNCCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Cl2FO3/c9-4-1-3(7(12)8(13)14)2-5(10)6(4)11/h1-2H,(H,13,14).
What are the key properties of 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid?
2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid has a molecular weight of 237.01 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dichloro-4-fluorophenyl)-2-oxoacetic acid is sourced from PubChem (CID 117345896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).